Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2195 | Purity: >98% |
 | |
| Chemical structure of BRL54443 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 57477-39-1 |
|---|---|
| Purity | >98% |
| Formula | C14H18N2O |
| Mol Weight | 230.3055 |
| CoA | CoA of BRL54443 |
| Smiles: | CN1CCC(CC1)C1=CNC2=C1C=C(O)C=C2 |
|---|
KEYWORDS: buy BRL54443 | BRL54443 supplier | purchase | cost | manufacturer | order | distributor | buy 57477-39-1 | 57477-39-1 supplier