Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1515 | Purity: >98% |
 | |
| Chemical structure of Brequinar |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 96187-53-0 |
|---|---|
| Purity | >98% |
| Formula | C23H15F2NO2 |
| Mol Weight | 375.3675 |
| CoA | CoA of Brequinar |
| Smiles: | CC1=C(C(O)=O)C2=CC(F)=CC=C2N=C1C1=CC=C(C=C1)C1=CC=CC=C1F |
|---|
KEYWORDS: buy Brequinar | Brequinar supplier | purchase | cost | manufacturer | order | distributor | buy 96187-53-0 | 96187-53-0 supplier