Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A692 | Purity: >98% |
 | |
| Chemical structure of BRD4770 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1374601-40-7 |
|---|---|
| Purity | >98% |
| Formula | C25H23N3O3 |
| Mol Weight | 413.4684 |
| CoA | CoA of BRD4770 |
| Smiles: | COC(=O)C1=CC=C2N(CCCC3=CC=CC=C3)C(NC(=O)C3=CC=CC=C3)=NC2=C1 |
|---|
KEYWORDS: buy BRD4770 | BRD4770 supplier | purchase | cost | manufacturer | order | distributor | buy 1374601-40-7 | 1374601-40-7 supplier