Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3464 | Purity: >98% |
 | |
| Chemical structure of BRD3308 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1550053-02-5 |
|---|---|
| Purity | >98% |
| Formula | C15H14FN3O2 |
| Mol Weight | 287.289 |
| CoA | CoA of BRD3308 |
| Smiles: | O=C(C)NC1=CC=C(C(NC2=CC=C(F)C=C2N)=O)C=C1 |
|---|
KEYWORDS: buy BRD3308 | BRD3308 supplier | purchase | cost | manufacturer | order | distributor | buy 1550053-02-5 | 1550053-02-5 supplier