Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2629 | Purity: >98% |
 | |
| Chemical structure of BRAF inhibitor |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 918505-61-0 |
|---|---|
| Purity | >98% |
| Formula | C22H18F2N4O3S |
| Mol Weight | 456.465 |
| CoA | CoA of BRAF inhibitor |
| Smiles: | CC(C)S(=O)(=O)NC1=CC=C(F)C(C(=O)C2=CNC3=NC=C(C=C23)C2=CC=CN=C2)=C1F |
|---|
KEYWORDS: buy BRAF inhibitor | BRAF inhibitor supplier | purchase | cost | manufacturer | order | distributor | buy 918505-61-0 | 918505-61-0 supplier