Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A14885 | Purity: >98% |
 | |
| Chemical structure of BPH-629 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 946417-20-5 |
|---|---|
| Purity | >98% |
| Formula | C20H18O8P2 |
| Mol Weight | 448.2996 |
| CoA | CoA of BPH-629 |
| Smiles: | C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)C4=CC=CC(=C4)CC(O)(P(=O)(O)O)P(=O)(O)O |
|---|
KEYWORDS: buy BPH-629 | BPH-629 supplier | purchase | cost | manufacturer | order | distributor | buy 946417-20-5 | 946417-20-5 supplier