Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A15883K | Purity: >98% |
 | |
| Chemical structure of Boc-Gly-Gly-Phe-Gly-Bn |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2922955-30-2 |
|---|---|
| Purity | >98% |
| Formula | C27H34N4O7 |
| Mol Weight | 526.5815 |
| CoA | CoA of Boc-Gly-Gly-Phe-Gly-Bn |
| Smiles: | [C@H](CC1=CC=CC=C1)(C(NCC(OCC2=CC=CC=C2)=O)=O)NC(CNC(CNC(OC(C)(C)C)=O)=O)=O |
|---|
KEYWORDS: buy Boc-Gly-Gly-Phe-Gly-Bn | Boc-Gly-Gly-Phe-Gly-Bn supplier | purchase | cost | manufacturer | order | distributor | buy 2922955-30-2 | 2922955-30-2 supplier