Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3038 | Purity: >98% |
 | |
| Chemical structure of BNC105P |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 945771-96-0 |
|---|---|
| Purity | >98% |
| Formula | C20H19Na2O10P |
| Mol Weight | 496.3122 |
| CoA | CoA of BNC105P |
| Smiles: | [Na+].[Na+].COC1=CC(=CC(OC)=C1OC)C(=O)C1=C(C)OC2=C1C=CC(OC)=C2OP([O-])([O-])=O |
|---|
KEYWORDS: buy BNC105P | BNC105P supplier | purchase | cost | manufacturer | order | distributor | buy 945771-96-0 | 945771-96-0 supplier