Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A789 | Purity: >98% |
 | |
| Chemical structure of BMS833923 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1059734-66-5 |
|---|---|
| Purity | >98% |
| Formula | C30H27N5O |
| Mol Weight | 473.5683 |
| CoA | CoA of BMS833923 |
| Smiles: | CNCC1=CC=C(C)C(NC(=O)C2=CC=C(NC3=NC(C4=CC=CC=C4)=C4C=CC=CC4=N3)C=C2)=C1 |
|---|
KEYWORDS: buy BMS833923 | BMS833923 supplier | purchase | cost | manufacturer | order | distributor | buy 1059734-66-5 | 1059734-66-5 supplier