Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2033 | Purity: 0.995 |
 | |
| Chemical structure of BMS345541 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 445430-58-0 |
|---|---|
| Purity | 0.995 |
| Formula | C14H17N5 |
| Mol Weight | 255.3183 |
| CoA | CoA of BMS345541 |
| Smiles: | CC1=CN=C2N1C1=CC(C)=CC=C1N=C2NCCN |
|---|
KEYWORDS: buy BMS345541 | BMS345541 supplier | purchase | cost | manufacturer | order | distributor | buy 445430-58-0 | 445430-58-0 supplier