Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2934 | Purity: >98% |
 | |
| Chemical structure of BMS-823778 hydrochloride |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1140898-87-8 |
|---|---|
| Purity | >98% |
| Formula | C18H19Cl2N3O |
| Mol Weight | 364.269 |
| CoA | CoA of BMS-823778 hydrochloride |
| Smiles: | Cl.CC(C)(O)C1=CC=CN2C1=NN=C2C1(CC1)C1=CC=C(Cl)C=C1 |
|---|
KEYWORDS: buy BMS-823778 hydrochloride | BMS-823778 hydrochloride supplier | purchase | cost | manufacturer | order | distributor | buy 1140898-87-8 | 1140898-87-8 supplier