Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A934 | Purity: >98% |
 | |
| Chemical structure of BMS-5 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1338247-35-0 |
|---|---|
| Purity | >98% |
| Formula | C17H14Cl2F2N4OS |
| Mol Weight | 431.287 |
| CoA | CoA of BMS-5 |
| Smiles: | CC(C)C(=O)NC1=NC=C(S1)C1=CC(=NN1C1=C(Cl)C=CC=C1Cl)C(F)F |
|---|
KEYWORDS: buy BMS-5 | BMS-5 supplier | purchase | cost | manufacturer | order | distributor | buy 1338247-35-0 | 1338247-35-0 supplier