Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3016 | Purity: >98% |
 | |
| Chemical structure of BLU782 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2141955-96-4 |
|---|---|
| Purity | >98% |
| Formula | C31H42N6O4 |
| Mol Weight | 562.703 |
| CoA | CoA of BLU782 |
| Smiles: | CCOC1(CCN(CC1)C(C)C)C1=CN=C(C=C1)C1=CN2N=CC=C(N3CCN(CC3)C(=O)O[C@@H]3CCOC3)C2=C1 |
|---|
KEYWORDS: buy BLU782 | BLU782 supplier | purchase | cost | manufacturer | order | distributor | buy 2141955-96-4 | 2141955-96-4 supplier