Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2513 | Purity: >98% |
 | |
| Chemical structure of BIX02565 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1311367-27-7 |
|---|---|
| Purity | >98% |
| Formula | C26H30N6O2 |
| Mol Weight | 458.5554 |
| CoA | CoA of BIX02565 |
| Smiles: | C[C@@H]1CCNC(=O)C2=CC3=C(C=C(C=C3)C(=O)NC3=NC4=CC=CC=C4N3CCCN(C)C)N12 |
|---|
KEYWORDS: buy BIX02565 | BIX02565 supplier | purchase | cost | manufacturer | order | distributor | buy 1311367-27-7 | 1311367-27-7 supplier