Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9946X | Purity: >98% |
 | |
| Chemical structure of Biotin-PEG15-Amine |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2134641-13-5 |
|---|---|
| Purity | >98% |
| Formula | C42H83ClN4O17S |
| Mol Weight | 983.643 |
| CoA | CoA of Biotin-PEG15-Amine |
| Smiles: | C(CCCC(NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN)=O)[C@H]1[C@@]2([C@](CS1)(NC(=O)N2)[H])[H].Cl |
|---|
KEYWORDS: buy Biotin-PEG15-Amine | Biotin-PEG15-Amine supplier | purchase | cost | manufacturer | order | distributor | buy 2134641-13-5 | 2134641-13-5 supplier