Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4073 | Purity: >98% |
 | |
| Chemical structure of Bindarit |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | AF2838 |
|---|---|
| CAS No. | 130641-38-2 |
| Purity | >98% |
| Formula | C19H20N2O3 |
| Mol Weight | 324.3737 |
| CoA | CoA of Bindarit |
| Smiles: | CC(OCC1=NN(CC2=CC=CC=C2)C3=C1C=CC=C3)(C)C(O)=O |
|---|
KEYWORDS: buy Bindarit | Bindarit supplier | purchase | cost | manufacturer | order | distributor | buy 130641-38-2 | 130641-38-2 supplier