Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13272 | Purity: >98% |
 | |
| Chemical structure of BIM 23313 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 216259-69-7 |
|---|---|
| Purity | >98% |
| Formula | C54H66IN11O10S2 |
| Mol Weight | 1220.204 |
| CoA | CoA of BIM 23313 |
| Smiles: | C(C=1C=2C(NC1)=CC=CC2)[C@H]3NC(=O)[C@H](CC4=CC(I)=C(O)C=C4)NC(=O)[C@H](CC5=CC=CC=C5)NC(=O)[C@@H](N)CSSC[C@@H](C(N)=O)NC(=O)[C@H](CC6=CC=CC=C6)NC(=O)[C@]([C@@H](C)O)(NC(=O)[C@H](CCCCN)NC3=O)[H] |
|---|
KEYWORDS: buy BIM 23313 | BIM 23313 supplier | purchase | cost | manufacturer | order | distributor | buy 216259-69-7 | 216259-69-7 supplier