Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2555 | Purity: >98% |
 | |
| Chemical structure of BI605906 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 960293-88-3 |
|---|---|
| Purity | >98% |
| Formula | C17H22F2N4O3S2 |
| Mol Weight | 432.508 |
| CoA | CoA of BI605906 |
| Smiles: | CCC(F)(F)C1=C2C(SC(C(N)=O)=C2N)=NC(=C1)N1CCC(CC1)S(C)(=O)=O |
|---|
KEYWORDS: buy BI605906 | BI605906 supplier | purchase | cost | manufacturer | order | distributor | buy 960293-88-3 | 960293-88-3 supplier