Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16190 | Purity: >98% |
 | |
| Chemical structure of BI-706321 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2205041-37-6 |
|---|---|
| Purity | >98% |
| Formula | C28H30F2N6O2 |
| Mol Weight | 520.5736 |
| CoA | CoA of BI-706321 |
| Smiles: | O=C(NC1CC1)C2=CC(C=3C=NN(C3)C4=CN=C5C=C(OC)C(=CN54)C6(F)CCN(C)CC6)=C(C=C2F)C |
|---|
KEYWORDS: buy BI-706321 | BI-706321 supplier | purchase | cost | manufacturer | order | distributor | buy 2205041-37-6 | 2205041-37-6 supplier