Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1307 | Purity: >98% |
 | |
| Chemical structure of BGP-15 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 66611-37-8 |
|---|---|
| Purity | >98% |
| Formula | C14H22N4O2 |
| Mol Weight | 278.3501 |
| CoA | CoA of BGP-15 |
| Smiles: | N\C(C1=CN=CC=C1)=N/OCC(O)CN1CCCCC1 |
|---|
KEYWORDS: buy BGP-15 | BGP-15 supplier | purchase | cost | manufacturer | order | distributor | buy 66611-37-8 | 66611-37-8 supplier