Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A11389 | Purity: >98% |
 | |
| Chemical structure of BG-GLA-OH |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | BG-COOH |
|---|---|
| CAS No. | 881663-34-9 |
| Purity | >98% |
| Formula | C18H20N6O4 |
| Mol Weight | 384.3892 |
| CoA | CoA of BG-GLA-OH |
| Smiles: | O=C(O)CCCC(=O)NCC1=CC=C(C=C1)COC2=NC(=NC=3N=CNC32)N |
|---|
KEYWORDS: buy BG-GLA-OH | BG-GLA-OH supplier | purchase | cost | manufacturer | order | distributor | buy 881663-34-9 | 881663-34-9 supplier