Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2381 | Purity: >98% |
 | |
| Chemical structure of Bevirimat |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | PA-457 |
|---|---|
| Synonyms 2 | MPC-4326 |
| CAS No. | 174022-42-5 |
| Purity | >98% |
| Formula | C36H56O6 |
| Mol Weight | 584.8262 |
| CoA | CoA of Bevirimat |
| Smiles: | [H][C@]12[C@@H](CC[C@@]1(CC[C@]1(C)[C@]2([H])CC[C@]2([H])[C@@]3(C)CC[C@H](OC(=O)CC(C)(C)C(O)=O)C(C)(C)[C@]3([H])CC[C@@]12C)C(O)=O)C(C)=C |
|---|
KEYWORDS: buy Bevirimat | Bevirimat supplier | purchase | cost | manufacturer | order | distributor | buy 174022-42-5 | 174022-42-5 supplier