Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A13109 | Purity: >98% |
 | |
| Chemical structure of Benzoquinazolinone 12 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1227923-91-2 |
|---|---|
| Purity | >98% |
| Formula | C28H27N5O2 |
| Mol Weight | 465.5463 |
| CoA | CoA of Benzoquinazolinone 12 |
| Smiles: | O=C1C=2C(=C3C(=C(CC=4C=CC(=NC4)C5=CN(C)N=C5)C2)C=CC=C3)N=CN1[C@@H]6[C@@H](O)CCCC6 |
|---|
KEYWORDS: buy Benzoquinazolinone 12 | Benzoquinazolinone 12 supplier | purchase | cost | manufacturer | order | distributor | buy 1227923-91-2 | 1227923-91-2 supplier