Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A620 | Purity: >98% |
 | |
| Chemical structure of BD-1047 dihydrobromide |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 138356-21-5 |
|---|---|
| Purity | >98% |
| Formula | C13H22Br2Cl2N2 |
| Mol Weight | 437.041 |
| CoA | CoA of BD-1047 dihydrobromide |
| Smiles: | Br[H].Br[H].CN(C)CCN(C)CCC1=CC=C(Cl)C(Cl)=C1 |
|---|
KEYWORDS: buy BD-1047 dihydrobromide | BD-1047 dihydrobromide supplier | purchase | cost | manufacturer | order | distributor | buy 138356-21-5 | 138356-21-5 supplier