Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16836H | Purity: >97% |
 | |
| Chemical structure of BCP-F2 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2381248-03-7 |
|---|---|
| Purity | >97% |
| Formula | C8H8F2O4 |
| Mol Weight | 206.1435 |
| CoA | CoA of BCP-F2 |
| Smiles: | O=C(O)C12CC(C(=O)OC)(C1)C2(F)F |
|---|
KEYWORDS: buy BCP-F2 | BCP-F2 supplier | purchase | cost | manufacturer | order | distributor | buy 2381248-03-7 | 2381248-03-7 supplier