Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12048 | Purity: |
 | |
| Chemical structure of BBO-10203 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2971769-60-3 |
|---|---|
| Formula | C34H30F2N6O3S |
| Mol Weight | 640.702 |
| CoA | CoA of BBO-10203 |
| Smiles: | O=C(C=C)N1CCN2N=C(C=C2C1C)C=3N=C(C=4C=CC5=C(C=NN5C)C4)C=6C=CSC6C3C7=C(F)C=C(F)C=C7OCCOC |
|---|
KEYWORDS: buy BBO-10203 | BBO-10203 supplier | purchase | cost | manufacturer | order | distributor | buy 2971769-60-3 | 2971769-60-3 supplier