Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1437 | Purity: >98% |
 | |
| Chemical structure of BAY-61-360 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 732983-37-8 |
|---|---|
| Purity | >98% |
| Formula | C20H18N6O3 |
| Mol Weight | 390.3953 |
| CoA | CoA of BAY-61-360 |
| Smiles: | COC1=C(OC)C=C(C=C1)C1=CC2=NC=CN2C(NC2=C(C=CC=N2)C(N)=O)=N1 |
|---|
KEYWORDS: buy BAY-61-360 | BAY-61-360 supplier | purchase | cost | manufacturer | order | distributor | buy 732983-37-8 | 732983-37-8 supplier