Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16443 | Purity: >98% |
 | |
| Chemical structure of Bavachromanol |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 74061-77-1 |
|---|---|
| Purity | >98% |
| Formula | C20H20O5 |
| Mol Weight | 340.3698 |
| CoA | CoA of Bavachromanol |
| Smiles: | C(/C=C/C1=CC=C(O)C=C1)(=O)C2=C3C(CC(O)C(C)(C)O3)=C(O)C=C2 |
|---|
KEYWORDS: buy Bavachromanol | Bavachromanol supplier | purchase | cost | manufacturer | order | distributor | buy 74061-77-1 | 74061-77-1 supplier