Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1671 | Purity: >98% |
 | |
| Chemical structure of Batimastat |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | BB-94 |
|---|---|
| CAS No. | 130370-60-4 |
| Purity | >98% |
| Formula | C23H31N3O4S2 |
| Mol Weight | 477.64 |
| CoA | CoA of Batimastat |
| Smiles: | CNC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(C)C)[C@H](CSC1=CC=CS1)C(=O)NO |
|---|
KEYWORDS: buy Batimastat | Batimastat supplier | purchase | cost | manufacturer | order | distributor | buy 130370-60-4 | 130370-60-4 supplier