Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A17582S | Purity: |
 | |
| Chemical structure of BAPM-diDOPO |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | D-DOPO-DPh-Diallyl |
|---|---|
| Synonyms 2 | BAPM-DOPO |
| CAS No. | 1207648-48-3 |
| Formula | C43H34O4P2 |
| Mol Weight | 676.6752 |
| CoA | CoA of BAPM-diDOPO |
| Smiles: | O=P1(OC=2C=CC=CC2C=3C=CC=CC31)C(C4=CC=C(C=C4)CC=C)(C5=CC=C(C=C5)CC=C)P6(=O)OC=7C=CC=CC7C=8C=CC=CC86 |
|---|
KEYWORDS: buy BAPM-diDOPO | BAPM-diDOPO supplier | purchase | cost | manufacturer | order | distributor | buy 1207648-48-3 | 1207648-48-3 supplier