Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1937 | Purity: >98% |
 | |
| Chemical structure of BAM7 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 331244-89-4 |
|---|---|
| Purity | >98% |
| Formula | C21H19N5O2S |
| Mol Weight | 405.473 |
| CoA | CoA of BAM7 |
| Smiles: | CCOC1=CC=CC=C1N\N=C1C(=O)N(N=C\1C)C1=NC(=CS1)C1=CC=CC=C1 |
|---|
KEYWORDS: buy BAM7 | BAM7 supplier | purchase | cost | manufacturer | order | distributor | buy 331244-89-4 | 331244-89-4 supplier