Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2631 | Purity: >98% |
 | |
| Chemical structure of B-Raf inhibitor |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1315330-11-0 |
|---|---|
| Purity | >98% |
| Formula | C29H31F3N6O2 |
| Mol Weight | 552.5906 |
| CoA | CoA of B-Raf inhibitor |
| Smiles: | CCN1CCN(CC2=CC=C(NC(=O)C3=CC(OC4=NC=NC5=C4C=C(C)N5)=C(C)C=C3)C=C2C(F)(F)F)CC1 |
|---|
KEYWORDS: buy B-Raf inhibitor | B-Raf inhibitor supplier | purchase | cost | manufacturer | order | distributor | buy 1315330-11-0 | 1315330-11-0 supplier