Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2861 | Purity: >98% |
 | |
| Chemical structure of Azinphosmethyl |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 86-50-0 |
|---|---|
| Purity | >98% |
| Formula | C10H12N3O3PS2 |
| Mol Weight | 317.324 |
| CoA | CoA of Azinphosmethyl |
| Smiles: | COP(=S)(OC)SCN1N=NC2=CC=CC=C2C1=O |
|---|
KEYWORDS: buy Azinphosmethyl | Azinphosmethyl supplier | purchase | cost | manufacturer | order | distributor | buy 86-50-0 | 86-50-0 supplier