Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1317 | Purity: >98% |
 | |
| Chemical structure of AZD5153 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1869912-39-9 |
|---|---|
| Purity | >98% |
| Formula | C25H33N7O3 |
| Mol Weight | 479.5746 |
| CoA | CoA of AZD5153 |
| Smiles: | COC1=NN=C2C=CC(=NN12)N1CCC(CC1)C1=CC=C(OCCN2CCN(C)C(=O)[C@H]2C)C=C1 |
|---|
KEYWORDS: buy AZD5153 | AZD5153 supplier | purchase | cost | manufacturer | order | distributor | buy 1869912-39-9 | 1869912-39-9 supplier