Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A16907 | Purity: >98% |
 | |
| Chemical structure of AZD3839 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1227163-83-8 |
|---|---|
| Purity | >98% |
| Formula | C24H16F3N5 |
| Mol Weight | 431.4125 |
| CoA | CoA of AZD3839 |
| Smiles: | FC1=CC=CC2=C1C(=NC2(C=3C=CN=C(C3)C(F)F)C=4C=CC=C(C4)C5=CN=CN=C5)N |
|---|
KEYWORDS: buy AZD3839 | AZD3839 supplier | purchase | cost | manufacturer | order | distributor | buy 1227163-83-8 | 1227163-83-8 supplier