Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A328 | Purity: >98% |
 | |
| Chemical structure of AZD-3463 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1356962-20-3 |
|---|---|
| Purity | >98% |
| Formula | C24H25ClN6O |
| Mol Weight | 448.948 |
| CoA | CoA of AZD-3463 |
| Smiles: | COC1=CC(=CC=C1NC1=NC=C(Cl)C(=N1)C1=CNC2=C1C=CC=C2)N1CCC(N)CC1 |
|---|
KEYWORDS: buy AZD-3463 | AZD-3463 supplier | purchase | cost | manufacturer | order | distributor | buy 1356962-20-3 | 1356962-20-3 supplier