Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A4958 | Purity: >98% |
 | |
| Chemical structure of AZ3976 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1418747-15-5 |
|---|---|
| Purity | >98% |
| Formula | C15H19N5O3 |
| Mol Weight | 317.3431 |
| CoA | CoA of AZ3976 |
| Smiles: | CC(C)(C)OC(=O)N1CC(C1)NC2=NC3=C(C=CC=N3)C(=O)N2 |
|---|
KEYWORDS: buy AZ3976 | AZ3976 supplier | purchase | cost | manufacturer | order | distributor | buy 1418747-15-5 | 1418747-15-5 supplier