Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2994 | Purity: >98% |
 | |
| Chemical structure of AUT1 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1311136-84-1 |
|---|---|
| Purity | >98% |
| Formula | C18H19N3O4 |
| Mol Weight | 341.3612 |
| CoA | CoA of AUT1 |
| Smiles: | CC[C@H]1NC(=O)N(C1=O)C1=CC=C(OC2=CC=C(C)C(OC)=C2)N=C1 |
|---|
KEYWORDS: buy AUT1 | AUT1 supplier | purchase | cost | manufacturer | order | distributor | buy 1311136-84-1 | 1311136-84-1 supplier