Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12728 | Purity: >98% |
 | |
| Chemical structure of ATTO Rho6G-NHS |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 2245700-42-7 |
|---|---|
| Purity | >98% |
| Formula | C35H39N4O6 |
| Mol Weight | 611.7074 |
| CoA | CoA of ATTO Rho6G-NHS |
| Smiles: | O=C(ON1C(=O)CCC1=O)CCCN(C(=O)C=2C=CC=CC2C=3C=4C=C(C(=CC4[O+]=C5C=C(NCC)C(=CC53)C)NCC)C)C |
|---|
KEYWORDS: buy ATTO Rho6G-NHS | ATTO Rho6G-NHS supplier | purchase | cost | manufacturer | order | distributor | buy 2245700-42-7 | 2245700-42-7 supplier