Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12720A | Purity: >98% |
 | |
| Chemical structure of ATN-161 acetate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 904763-58-2 |
|---|---|
| Purity | >98% |
| Formula | C25H39N9O10S |
| Mol Weight | 657.696 |
| CoA | CoA of ATN-161 acetate |
| Smiles: | C(C)(O)=O.C(N[C@@H](CC1=CN=CN1)C(N[C@H](C(N[C@H](C(N[C@@H](CC(N)=O)C(N)=O)=O)CS)=O)CO)=O)(=O)[C@H]2N(C(C)=O)CCC2 |
|---|
KEYWORDS: buy ATN-161 acetate | ATN-161 acetate supplier | purchase | cost | manufacturer | order | distributor | buy 904763-58-2 | 904763-58-2 supplier