Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A225 | Purity: >98% |
 | |
| Chemical structure of AT7519 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 844442-38-2 |
|---|---|
| Purity | >98% |
| Formula | C16H17Cl2N5O2 |
| Mol Weight | 382.244 |
| CoA | CoA of AT7519 |
| Smiles: | ClC1=CC=CC(Cl)=C1C(=O)NC1=CNN=C1C(=O)NC1CCNCC1 |
|---|
KEYWORDS: buy AT7519 | AT7519 supplier | purchase | cost | manufacturer | order | distributor | buy 844442-38-2 | 844442-38-2 supplier