Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A9111 | Purity: >98% |
 | |
| Chemical structure of ASP6918 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Purity | >98% |
|---|---|
| Formula | C36H43N7O3 |
| Mol Weight | 621.7717 |
| CoA | CoA of ASP6918 |
| Smiles: | C=CC1=CC2=C(N=C(OC3CCN(C)CC3)N=C2N4CCC5(CN(C(C=C)=O)C5)CC4)C(OCC)=[C@]1[C@]6=C(C)C=CC7=C6C=NN7 |
|---|
KEYWORDS: buy ASP6918 | ASP6918 supplier | purchase | cost | manufacturer | order | distributor | buy | supplier