Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A140 | Purity: >98% |
 | |
| Chemical structure of ASP3026 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1097917-15-1 |
|---|---|
| Purity | >98% |
| Formula | C29H40N8O3S |
| Mol Weight | 580.745 |
| CoA | CoA of ASP3026 |
| Smiles: | COC1=CC(=CC=C1NC1=NC(NC2=CC=CC=C2S(=O)(=O)C(C)C)=NC=N1)N1CCC(CC1)N1CCN(C)CC1 |
|---|
KEYWORDS: buy ASP3026 | ASP3026 supplier | purchase | cost | manufacturer | order | distributor | buy 1097917-15-1 | 1097917-15-1 supplier