Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A2993 | Purity: >98% |
 | |
| Chemical structure of Asapiprant |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 932372-01-5 |
|---|---|
| Purity | >98% |
| Formula | C24H27N3O7S |
| Mol Weight | 501.552 |
| CoA | CoA of Asapiprant |
| Smiles: | CC(C)OC1=CC=C(C=C1)S(=O)(=O)N1CCN(CC1)C1=CC=C(C2=NC=CO2)C(OCC(O)=O)=C1 |
|---|
KEYWORDS: buy Asapiprant | Asapiprant supplier | purchase | cost | manufacturer | order | distributor | buy 932372-01-5 | 932372-01-5 supplier