Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A473 | Purity: >98% |
 | |
| Chemical structure of AS-252424 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 900515-16-4 |
|---|---|
| Purity | >98% |
| Formula | C14H8FNO4S |
| Mol Weight | 305.281 |
| CoA | CoA of AS-252424 |
| Smiles: | OC1=CC(F)=CC=C1C1=CC=C(O1)\C=C1/SC(=O)NC1=O |
|---|
KEYWORDS: buy AS-252424 | AS-252424 supplier | purchase | cost | manufacturer | order | distributor | buy 900515-16-4 | 900515-16-4 supplier