Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A12248 | Purity: >98% |
 | |
| Chemical structure of Artefenomel Mesylate |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1029939-87-4 |
|---|---|
| Purity | >98% |
| Formula | C29H43NO8S |
| Mol Weight | 565.719 |
| CoA | CoA of Artefenomel Mesylate |
| Smiles: | S(C)(=O)(=O)O.O(CCN1CCOCC1)C2=CC=C([C@@H]3CC[C@@]4(OC5([C@]6(CC7C[C@@]5(CC(C6)C7)[H])[H])OO4)CC3)C=C2 |
|---|
KEYWORDS: buy Artefenomel Mesylate | Artefenomel Mesylate supplier | purchase | cost | manufacturer | order | distributor | buy 1029939-87-4 | 1029939-87-4 supplier