Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A1689 | Purity: >98% |
 | |
| Chemical structure of ARS853 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1629268-00-3 |
|---|---|
| Purity | >98% |
| Formula | C22H29ClN4O3 |
| Mol Weight | 432.944 |
| CoA | CoA of ARS853 |
| Smiles: | CC1(CC1)C1=C(Cl)C=C(O)C(NCC(=O)N2CCN(CC2)C2CN(C2)C(=O)C=C)=C1 |
|---|
KEYWORDS: buy ARS853 | ARS853 supplier | purchase | cost | manufacturer | order | distributor | buy 1629268-00-3 | 1629268-00-3 supplier