Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3148 | Purity: >98% |
 | |
| Chemical structure of ARRY-797 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | ARRY-371797 |
|---|---|
| CAS No. | 1034189-82-6 |
| Purity | >98% |
| Formula | C22H26F2N4O2 |
| Mol Weight | 416.4642 |
| CoA | CoA of ARRY-797 |
| Smiles: | O=C(C1=CC2=C(C=C1OC3=CC=C(F)C=C3F)C=NN2CC(C)C)NCCN(C)C |
|---|
KEYWORDS: buy ARRY-797 | ARRY-797 supplier | purchase | cost | manufacturer | order | distributor | buy 1034189-82-6 | 1034189-82-6 supplier