Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A305 | Purity: >98% |
 | |
| Chemical structure of APY29 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1216665-49-4 |
|---|---|
| Purity | >98% |
| Formula | C17H16N8 |
| Mol Weight | 332.3625 |
| CoA | CoA of APY29 |
| Smiles: | C1CC1C1=CC(NC2=NC(NC3=CC=C4N=CNC4=C3)=NC=C2)=NN1 |
|---|
KEYWORDS: buy APY29 | APY29 supplier | purchase | cost | manufacturer | order | distributor | buy 1216665-49-4 | 1216665-49-4 supplier