Inhibitor Specialist 
Product Information:
| Cat. No.: EX-A3109 | Purity: >98% |
 | |
| Chemical structure of APY0201 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:[email protected]; or Fax:+86 020 81619670 |
| Discount Request |
| CAS No. | 1232221-74-7 |
|---|---|
| Purity | >98% |
| Formula | C23H23N7O |
| Mol Weight | 413.475 |
| CoA | CoA of APY0201 |
| Smiles: | CC1=CC(/C=N/NC2=NC3=CC(C4=CC=NC=C4)=NN3C(N5CCOCC5)=C2)=CC=C1 |
|---|
KEYWORDS: buy APY0201 | APY0201 supplier | purchase | cost | manufacturer | order | distributor | buy 1232221-74-7 | 1232221-74-7 supplier